Products 1227945-07-4
CAS 1227945-07-4 appears in our catalog under these names: 4-Chloropyridine-2,5-dicarboxylic acid, 4-Chloropyridine-2,5-dicarboxylic acid, 98%, 4-Chloropyridine-2,5-dicarboxylic acid, 95%, 4-Chloropyridine-2,5-dicarboxylic acid, 95%, 95%. Offered by: Biosynth, Fluorochem, Ambeed, BLDpharm, Chemat. Available pack sizes: 50mg, 0,5g, 1g, 25mg, 100mg, 250mg.
4-chloropyridine-2,5-dicarboxylic acid (CAS 1227945-07-4) is a chemical compound with the molecular formula C7H4ClNO4 and a molecular weight of 201.56 g/mol. IUPAC name: 4-chloropyridine-2,5-dicarboxylic acid. InChIKey: KXNBJIIPZFBSPA-UHFFFAOYSA-N.
| Molecular formula | C7H4ClNO4 |
|---|---|
| Molecular weight | 201.56 g/mol |
| IUPAC name | 4-chloropyridine-2,5-dicarboxylic acid |
| InChIKey | KXNBJIIPZFBSPA-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CN=C1C(=O)O)C(=O)O)Cl |
Computed by PubChem (NCBI)
Synonyms:
4-chloro-2,5-pyridinedicarboxylic acid