CAS 1228078-57-6 appears in our catalog under these names: R-3-Hydroxyisobutyric acid sodium salt, (R)-3-Hydroxyisobutyric acid (sodium). Offered by: Chemat, MedChemExpress. Available pack sizes: 100mg, Get quote.
Sodium (2R)-3-hydroxy-2-methylpropanoate (CAS 1228078-57-6) is a chemical compound with the molecular formula C4H7NaO3 and a molecular weight of 126.09 g/mol. IUPAC name: sodium (2R)-3-hydroxy-2-methylpropanoate. InChIKey: RBJZIQZDAZLXEK-AENDTGMFSA-M.
| Molecular formula | C4H7NaO3 |
|---|---|
| Molecular weight | 126.09 g/mol |
| IUPAC name | sodium (2R)-3-hydroxy-2-methylpropanoate |
| InChIKey | RBJZIQZDAZLXEK-AENDTGMFSA-M |
| SMILES | C[C@H](CO)C(=O)[O-].[Na+] |
Computed by PubChem (NCBI)