Products 2514847-30-2
CAS 2514847-30-2 is the registry number for (S)-3-Hydroxy-2-methylpropanoic Acid-d3 sodium salt. Offered by: TRC. Available pack sizes: 10mg, 1mg, 5mg.
Sodium (2S)-3,3,3-trideuterio-2-(hydroxymethyl)propanoate (CAS 2514847-30-2) is a chemical compound with the molecular formula C4H7NaO3 and a molecular weight of 129.10 g/mol. IUPAC name: sodium (2S)-3,3,3-trideuterio-2-(hydroxymethyl)propanoate. InChIKey: RBJZIQZDAZLXEK-YUKGPTQOSA-M.
| Molecular formula | C4H7NaO3 |
|---|---|
| Molecular weight | 129.10 g/mol |
| IUPAC name | sodium (2S)-3,3,3-trideuterio-2-(hydroxymethyl)propanoate |
| InChIKey | RBJZIQZDAZLXEK-YUKGPTQOSA-M |
| SMILES | [2H]C([2H])([2H])[C@@H](CO)C(=O)[O-].[Na+] |
Computed by PubChem (NCBI)