CAS 1228092-84-9 appears in our catalog under these names: (1R,2S)-2-(4-Bromophenyl)cyclopropan-1-amine hydrochloride, 97% 96%ee, 97% 96%ee, (1R,2S)-2-(4-Bromophenyl)cyclopropan-1-amine hydrochloride, 97% 96%ee. Offered by: Chemat, Ambeed. Available pack sizes: 100mg, 250mg, 1g.
Trans-(1R,2S)-2-(4-bromophenyl)cyclopropan-1-amine;hydrochloride (CAS 1228092-84-9) is a chemical compound with the molecular formula C9H11BrClN and a molecular weight of 248.55 g/mol. IUPAC name: trans-(1R,2S)-2-(4-bromophenyl)cyclopropan-1-amine;hydrochloride. InChIKey: XQXNVLZRIWWINX-OULXEKPRSA-N.
| Molecular formula | C9H11BrClN |
|---|---|
| Molecular weight | 248.55 g/mol |
| IUPAC name | trans-(1R,2S)-2-(4-bromophenyl)cyclopropan-1-amine;hydrochloride |
| InChIKey | XQXNVLZRIWWINX-OULXEKPRSA-N |
| SMILES | C1[C@H]([C@@H]1N)C2=CC=C(C=C2)Br.Cl |
Computed by PubChem (NCBI)