CAS 26568-24-1 is the registry number for trans-2-(4-Bromophenyl)cyclopropylamine hydrochloride, 95%, 95%. Offered by: Chemat. Available pack sizes: 1g.
Trans-(1R,2S)-2-(4-bromophenyl)cyclopropan-1-amine;hydrochloride (CAS 26568-24-1) is a chemical compound with the molecular formula C9H11BrClN and a molecular weight of 248.55 g/mol. IUPAC name: trans-(1R,2S)-2-(4-bromophenyl)cyclopropan-1-amine;hydrochloride. InChIKey: XQXNVLZRIWWINX-OULXEKPRSA-N.
| Molecular formula | C9H11BrClN |
|---|---|
| Molecular weight | 248.55 g/mol |
| IUPAC name | trans-(1R,2S)-2-(4-bromophenyl)cyclopropan-1-amine;hydrochloride |
| InChIKey | XQXNVLZRIWWINX-OULXEKPRSA-N |
| SMILES | C1[C@H]([C@@H]1N)C2=CC=C(C=C2)Br.Cl |
Computed by PubChem (NCBI)