Products 1228143-76-7
CAS 1228143-76-7 is the registry number for LSD1-IN-12. Offered by: MedChemExpress. Available pack sizes: Get quote.
N-[4-[(1S,2R)-2-aminocyclopropyl]phenyl]benzamide (CAS 1228143-76-7) is a chemical compound with the molecular formula C16H16N2O and a molecular weight of 252.31 g/mol. IUPAC name: N-[4-[(1S,2R)-2-aminocyclopropyl]phenyl]benzamide. InChIKey: FFYGOYSNGFPHEN-LSDHHAIUSA-N.
| Molecular formula | C16H16N2O |
|---|---|
| Molecular weight | 252.31 g/mol |
| IUPAC name | N-[4-[(1S,2R)-2-aminocyclopropyl]phenyl]benzamide |
| InChIKey | FFYGOYSNGFPHEN-LSDHHAIUSA-N |
| SMILES | C1[C@H]([C@@H]1N)C2=CC=C(C=C2)NC(=O)C3=CC=CC=C3 |
Computed by PubChem (NCBI)