CAS 1228552-59-7 is the registry number for 2-(Chloroacetyl)-4,5-dimethoxybenzonitrile, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
2-(2-chloroacetyl)-4,5-dimethoxybenzonitrile (CAS 1228552-59-7) is a chemical compound with the molecular formula C11H10ClNO3 and a molecular weight of 239.65 g/mol. IUPAC name: 2-(2-chloroacetyl)-4,5-dimethoxybenzonitrile. InChIKey: KGEWFPQYUZNYSQ-UHFFFAOYSA-N.
| Molecular formula | C11H10ClNO3 |
|---|---|
| Molecular weight | 239.65 g/mol |
| IUPAC name | 2-(2-chloroacetyl)-4,5-dimethoxybenzonitrile |
| InChIKey | KGEWFPQYUZNYSQ-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C(=C1)C#N)C(=O)CCl)OC |
Computed by PubChem (NCBI)