CAS 1228557-42-3 appears in our catalog under these names: Boc-Phg(3-OMe)-OH 95%, Boc-(S)-2-amino-2-(3-methoxyphenyl)acetic acid, 95%, (s)-2-((Tert-butoxycarbonyl)amino)-2-(3-methoxyphenyl)acetic acid, 98%. Offered by: Ambeed, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g.
(2S)-2-(3-methoxyphenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]acetic acid (CAS 1228557-42-3) is a chemical compound with the molecular formula C14H19NO5 and a molecular weight of 281.30 g/mol. IUPAC name: (2S)-2-(3-methoxyphenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]acetic acid. InChIKey: ZPMHSWFMWHVVHG-NSHDSACASA-N.
| Molecular formula | C14H19NO5 |
|---|---|
| Molecular weight | 281.30 g/mol |
| IUPAC name | (2S)-2-(3-methoxyphenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]acetic acid |
| InChIKey | ZPMHSWFMWHVVHG-NSHDSACASA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](C1=CC(=CC=C1)OC)C(=O)O |
Computed by PubChem (NCBI)