CAS 1228880-28-1 appears in our catalog under these names: 1–(3–fluorophenyl)cyclobutan–1–amine hydrochloride, 1-(3-Fluorophenyl)cyclobutan-1-amine hydrochloride, 1-(3-Fluorophenyl)cyclobutanamine hydrochloride, 95%, 1-(3-Fluorophenyl)cyclobutanamine hydrochloride, 95+%. Offered by: GLPBio, Biosynth, Chemat, Combi-blocks, AmBeed. Available pack sizes: 100mg, 1g, 0,5g, 50mg, 5g, 10g, 250mg.
1-(3-fluorophenyl)cyclobutan-1-amine;hydrochloride (CAS 1228880-28-1) is a chemical compound with the molecular formula C10H13ClFN and a molecular weight of 201.67 g/mol. IUPAC name: 1-(3-fluorophenyl)cyclobutan-1-amine;hydrochloride. InChIKey: VHXWQJRNYMKPIA-UHFFFAOYSA-N.
| Molecular formula | C10H13ClFN |
|---|---|
| Molecular weight | 201.67 g/mol |
| IUPAC name | 1-(3-fluorophenyl)cyclobutan-1-amine;hydrochloride |
| InChIKey | VHXWQJRNYMKPIA-UHFFFAOYSA-N |
| SMILES | C1CC(C1)(C2=CC(=CC=C2)F)N.Cl |
Computed by PubChem (NCBI)