CAS 1231709-24-2 is the registry number for H-alpha-Me-L-Phe(3-NO2)-OH. Offered by: Creative Peptides. Available pack sizes: 1g.
(2S)-2-amino-2-methyl-3-(4-phenylphenyl)propanoic acid (CAS 1231709-24-2) is a chemical compound with the molecular formula C16H17NO2 and a molecular weight of 255.31 g/mol. IUPAC name: (2S)-2-amino-2-methyl-3-(4-phenylphenyl)propanoic acid. InChIKey: KGPOAGRUGOUXOK-INIZCTEOSA-N.
| Molecular formula | C16H17NO2 |
|---|---|
| Molecular weight | 255.31 g/mol |
| IUPAC name | (2S)-2-amino-2-methyl-3-(4-phenylphenyl)propanoic acid |
| InChIKey | KGPOAGRUGOUXOK-INIZCTEOSA-N |
| SMILES | C[C@](CC1=CC=C(C=C1)C2=CC=CC=C2)(C(=O)O)N |
Computed by PubChem (NCBI)