Products 1232141-38-6

CAS 1232141-38-6 is the registry number for 2-Bromo-6-hydroxynicotinic acid, 97%. Offered by: AmBeed. Available pack sizes: 1g.

Structural formula: {0} (CAS {1})

2-bromo-6-oxo-1H-pyridine-3-carboxylic acid (CAS 1232141-38-6) is a chemical compound with the molecular formula C6H4BrNO3 and a molecular weight of 218.00 g/mol. IUPAC name: 2-bromo-6-oxo-1H-pyridine-3-carboxylic acid. InChIKey: XDEFTPDCDRIZFL-UHFFFAOYSA-N.

Identity
Molecular formulaC6H4BrNO3
Molecular weight218.00 g/mol
IUPAC name2-bromo-6-oxo-1H-pyridine-3-carboxylic acid
InChIKeyXDEFTPDCDRIZFL-UHFFFAOYSA-N
SMILESC1=CC(=O)NC(=C1C(=O)O)Br

Computed by PubChem (NCBI)