Products 123297-52-9
CAS 123297-52-9 is the registry number for ICI-170777. Offered by: MedChemExpress. Available pack sizes: Get quote.
6-methyl-5-pyridin-4-yl-3,6-dihydro-1,3,4-thiadiazin-2-one (CAS 123297-52-9) is a chemical compound with the molecular formula C9H9N3OS and a molecular weight of 207.25 g/mol. IUPAC name: 6-methyl-5-pyridin-4-yl-3,6-dihydro-1,3,4-thiadiazin-2-one. InChIKey: PXZLHVGFLSUUIW-UHFFFAOYSA-N.
| Molecular formula | C9H9N3OS |
|---|---|
| Molecular weight | 207.25 g/mol |
| IUPAC name | 6-methyl-5-pyridin-4-yl-3,6-dihydro-1,3,4-thiadiazin-2-one |
| InChIKey | PXZLHVGFLSUUIW-UHFFFAOYSA-N |
| SMILES | CC1C(=NNC(=O)S1)C2=CC=NC=C2 |
Computed by PubChem (NCBI)