Products 2732915-77-2
CAS 2732915-77-2 appears in our catalog under these names: Sulfisomidine-d4, Sulfisomidin-d4, D4-Sulfisomidine, D4-Sulfisomidine, Concentration: 100 µg/ml Solvent: Acetonitrile. Offered by: TRC, MedChemExpress, HPC Standards. Available pack sizes: 100mg, Get quote, 1x5mg, 1x1ml.
4-amino-2,3,5,6-tetradeuterio-N-(2,6-dimethylpyrimidin-4-yl)benzenesulfonamide (CAS 2732915-77-2) is a chemical compound with the molecular formula C12H14N4O2S and a molecular weight of 282.36 g/mol. IUPAC name: 4-amino-2,3,5,6-tetradeuterio-N-(2,6-dimethylpyrimidin-4-yl)benzenesulfonamide. InChIKey: YZMCKZRAOLZXAZ-LNFUJOGGSA-N.
| Molecular formula | C12H14N4O2S |
|---|---|
| Molecular weight | 282.36 g/mol |
| IUPAC name | 4-amino-2,3,5,6-tetradeuterio-N-(2,6-dimethylpyrimidin-4-yl)benzenesulfonamide |
| InChIKey | YZMCKZRAOLZXAZ-LNFUJOGGSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1N)[2H])[2H])S(=O)(=O)NC2=NC(=NC(=C2)C)C)[2H] |
Computed by PubChem (NCBI)
Synonyms:
Sulfisomidine-d4, Sulfisomidin-d4