Products 1233395-93-1
CAS 1233395-93-1 appears in our catalog under these names: L–Tryptophan–d8, L-Tryptophan-d8, 98.0%. Offered by: GLPBio, MedChemExpress. Available pack sizes: 1mg, 10mg, 5mg, 25 mg, 100 mg, 50 mg, 1 mg, 10 mg.
(2S)-2-amino-2,3,3-trideuterio-3-(2,4,5,6,7-pentadeuterio-1H-indol-3-yl)propanoic acid (CAS 1233395-93-1) is a chemical compound with the molecular formula C11H12N2O2 and a molecular weight of 212.27 g/mol. IUPAC name: (2S)-2-amino-2,3,3-trideuterio-3-(2,4,5,6,7-pentadeuterio-1H-indol-3-yl)propanoic acid. InChIKey: QIVBCDIJIAJPQS-CIATZEAISA-N.
| Molecular formula | C11H12N2O2 |
|---|---|
| Molecular weight | 212.27 g/mol |
| IUPAC name | (2S)-2-amino-2,3,3-trideuterio-3-(2,4,5,6,7-pentadeuterio-1H-indol-3-yl)propanoic acid |
| InChIKey | QIVBCDIJIAJPQS-CIATZEAISA-N |
| SMILES | [2H]C1=C(C(=C2C(=C1[2H])C(=C(N2)[2H])C([2H])([2H])[C@@]([2H])(C(=O)O)N)[2H])[2H] |
Computed by PubChem (NCBI)