CAS 1234616-12-6 is the registry number for Ethyl 4-chloro-6-azaindole-3-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
Ethyl 4-chloro-1H-pyrrolo[2,3-c]pyridine-3-carboxylate (CAS 1234616-12-6) is a chemical compound with the molecular formula C10H9ClN2O2 and a molecular weight of 224.64 g/mol. IUPAC name: ethyl 4-chloro-1H-pyrrolo[2,3-c]pyridine-3-carboxylate. InChIKey: BDJGZEWHTDMFSL-UHFFFAOYSA-N.
| Molecular formula | C10H9ClN2O2 |
|---|---|
| Molecular weight | 224.64 g/mol |
| IUPAC name | ethyl 4-chloro-1H-pyrrolo[2,3-c]pyridine-3-carboxylate |
| InChIKey | BDJGZEWHTDMFSL-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CNC2=CN=CC(=C12)Cl |
Computed by PubChem (NCBI)