CAS 1235407-51-8 appears in our catalog under these names: 2,4-Difluoro-5-methylbenzenesulfonyl chloride, 95%, 2,4-DIfluoro-5-methylbenzene-1-sulfonyl chloride, 97%, 2,4-Difluoro-5-methylbenzenesulfonyl chloride, 97%, 97%, 2,4-Difluoro-5-methylbenzenesulfonyl chloride, 97%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 100mg, 10g, 250mg, 500mg.
2,4-difluoro-5-methylbenzenesulfonyl chloride (CAS 1235407-51-8) is a chemical compound with the molecular formula C7H5ClF2O2S and a molecular weight of 226.63 g/mol. IUPAC name: 2,4-difluoro-5-methylbenzenesulfonyl chloride. InChIKey: UHQWNCRFCWGHEX-UHFFFAOYSA-N.
| Molecular formula | C7H5ClF2O2S |
|---|---|
| Molecular weight | 226.63 g/mol |
| IUPAC name | 2,4-difluoro-5-methylbenzenesulfonyl chloride |
| InChIKey | UHQWNCRFCWGHEX-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1F)F)S(=O)(=O)Cl |
Computed by PubChem (NCBI)