CAS 163295-73-6 appears in our catalog under these names: (3,4-Difluorophenyl)methanesulfonyl chloride, 97%, (3,4-Difluorophenyl)methanesulfonyl chloride 95%, 3,4-Difluorobenzylsulfonyl chloride, 95%. Offered by: AmBeed, Fluorochem. Available pack sizes: 25g, 100mg, 250mg, 1g, 5g.
(3,4-difluorophenyl)methanesulfonyl chloride (CAS 163295-73-6) is a chemical compound with the molecular formula C7H5ClF2O2S and a molecular weight of 226.63 g/mol. IUPAC name: (3,4-difluorophenyl)methanesulfonyl chloride. InChIKey: CBFHDOKDFDXNES-UHFFFAOYSA-N.
| Molecular formula | C7H5ClF2O2S |
|---|---|
| Molecular weight | 226.63 g/mol |
| IUPAC name | (3,4-difluorophenyl)methanesulfonyl chloride |
| InChIKey | CBFHDOKDFDXNES-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1CS(=O)(=O)Cl)F)F |
Computed by PubChem (NCBI)