CAS 163295-74-7 appears in our catalog under these names: (3,5-Difluorophenyl)methanesulfonyl chloride, 95%, (3,5-Difluorophenyl)methanesulfonyl chloride 95%, (3,5-Difluorophenyl)methanesulfonyl chloride, 97%. Offered by: Combi-blocks, Ambeed, Fluorochem. Available pack sizes: 1g, 250mg, 5g.
(3,5-difluorophenyl)methanesulfonyl chloride (CAS 163295-74-7) is a chemical compound with the molecular formula C7H5ClF2O2S and a molecular weight of 226.63 g/mol. IUPAC name: (3,5-difluorophenyl)methanesulfonyl chloride. InChIKey: VJJZLXRMDXUBPP-UHFFFAOYSA-N.
| Molecular formula | C7H5ClF2O2S |
|---|---|
| Molecular weight | 226.63 g/mol |
| IUPAC name | (3,5-difluorophenyl)methanesulfonyl chloride |
| InChIKey | VJJZLXRMDXUBPP-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1F)F)CS(=O)(=O)Cl |
Computed by PubChem (NCBI)