Products 179524-60-8

CAS 179524-60-8 appears in our catalog under these names: (2,6-Difluorophenyl)methanesulfonyl chloride, 95%, (2,6-Difluorophenyl)methanesulphonyl chloride, (2,6-Difluorophenyl)methanesulfonyl chloride 95%. Offered by: Combi-blocks, Biosynth, Ambeed. Available pack sizes: 1g, 250mg, 2,5g, 100mg.

Structural formula: {0} (CAS {1})

(2,6-difluorophenyl)methanesulfonyl chloride (CAS 179524-60-8) is a chemical compound with the molecular formula C7H5ClF2O2S and a molecular weight of 226.63 g/mol. IUPAC name: (2,6-difluorophenyl)methanesulfonyl chloride. InChIKey: VLBAKONQZABMSE-UHFFFAOYSA-N.

Identity
Molecular formulaC7H5ClF2O2S
Molecular weight226.63 g/mol
IUPAC name(2,6-difluorophenyl)methanesulfonyl chloride
InChIKeyVLBAKONQZABMSE-UHFFFAOYSA-N
SMILESC1=CC(=C(C(=C1)F)CS(=O)(=O)Cl)F

Computed by PubChem (NCBI)