CAS 1394040-05-1 appears in our catalog under these names: 2,5-Difluoro-4-methylbenzene-1-sulfonyl chloride, 2,5-Difluoro-4-methylbenzene-1-sulfonyl chloride, 95%. Offered by: Biosynth, AmBeed. Available pack sizes: 50mg, 0,5g, 1g.
2,5-difluoro-4-methylbenzenesulfonyl chloride (CAS 1394040-05-1) is a chemical compound with the molecular formula C7H5ClF2O2S and a molecular weight of 226.63 g/mol. IUPAC name: 2,5-difluoro-4-methylbenzenesulfonyl chloride. InChIKey: CAIAONLMJMHUKR-UHFFFAOYSA-N.
| Molecular formula | C7H5ClF2O2S |
|---|---|
| Molecular weight | 226.63 g/mol |
| IUPAC name | 2,5-difluoro-4-methylbenzenesulfonyl chloride |
| InChIKey | CAIAONLMJMHUKR-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1F)S(=O)(=O)Cl)F |
Computed by PubChem (NCBI)