Products 179524-62-0
CAS 179524-62-0 appears in our catalog under these names: (2,5-Difluorophenyl)methanesulfonyl chloride, 95%, 2,5-Difluorobenzylsulfonyl chloride, 97%. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 1g, 250mg, 5g, 25g.
(2,5-difluorophenyl)methanesulfonyl chloride (CAS 179524-62-0) is a chemical compound with the molecular formula C7H5ClF2O2S and a molecular weight of 226.63 g/mol. IUPAC name: (2,5-difluorophenyl)methanesulfonyl chloride. InChIKey: QBVRECXGNKZPIM-UHFFFAOYSA-N.
| Molecular formula | C7H5ClF2O2S |
|---|---|
| Molecular weight | 226.63 g/mol |
| IUPAC name | (2,5-difluorophenyl)methanesulfonyl chloride |
| InChIKey | QBVRECXGNKZPIM-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1F)CS(=O)(=O)Cl)F |
Computed by PubChem (NCBI)