CAS 1235438-81-9 is the registry number for 2,2,2-Trifluoroethyl N-(4-phenyl-1,3-thiazol-2-yl)carbamate. Offered by: Biosynth. Available pack sizes: 2,5g, 250mg.
2,2,2-trifluoroethyl N-(4-phenyl-1,3-thiazol-2-yl)carbamate (CAS 1235438-81-9) is a chemical compound with the molecular formula C12H9F3N2O2S and a molecular weight of 302.27 g/mol. IUPAC name: 2,2,2-trifluoroethyl N-(4-phenyl-1,3-thiazol-2-yl)carbamate. InChIKey: IIPKPJLCVVWAFH-UHFFFAOYSA-N.
| Molecular formula | C12H9F3N2O2S |
|---|---|
| Molecular weight | 302.27 g/mol |
| IUPAC name | 2,2,2-trifluoroethyl N-(4-phenyl-1,3-thiazol-2-yl)carbamate |
| InChIKey | IIPKPJLCVVWAFH-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CSC(=N2)NC(=O)OCC(F)(F)F |
Computed by PubChem (NCBI)