CAS 82424-65-5 is the registry number for Methyl 4-amino-3-(3-(trifluoromethyl)phenyl)-1,2-thiazole-5-carboxylate. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
Methyl 4-amino-3-[3-(trifluoromethyl)phenyl]-1,2-thiazole-5-carboxylate (CAS 82424-65-5) is a chemical compound with the molecular formula C12H9F3N2O2S and a molecular weight of 302.27 g/mol. IUPAC name: methyl 4-amino-3-[3-(trifluoromethyl)phenyl]-1,2-thiazole-5-carboxylate. InChIKey: NUBIGKPQVCRUKD-UHFFFAOYSA-N.
| Molecular formula | C12H9F3N2O2S |
|---|---|
| Molecular weight | 302.27 g/mol |
| IUPAC name | methyl 4-amino-3-[3-(trifluoromethyl)phenyl]-1,2-thiazole-5-carboxylate |
| InChIKey | NUBIGKPQVCRUKD-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C(=NS1)C2=CC(=CC=C2)C(F)(F)F)N |
Computed by PubChem (NCBI)