Products 276686-79-4
CAS 276686-79-4 is the registry number for Ethyl 2-(4-(trifluoromethyl)pyridin-3-yl)thiazole-4-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Ethyl 2-[4-(trifluoromethyl)-3-pyridinyl]-1,3-thiazole-4-carboxylate (CAS 276686-79-4) is a chemical compound with the molecular formula C12H9F3N2O2S and a molecular weight of 302.27 g/mol. IUPAC name: ethyl 2-[4-(trifluoromethyl)-3-pyridinyl]-1,3-thiazole-4-carboxylate. InChIKey: JVEWMCVXHXWPRB-UHFFFAOYSA-N.
| Molecular formula | C12H9F3N2O2S |
|---|---|
| Molecular weight | 302.27 g/mol |
| IUPAC name | ethyl 2-[4-(trifluoromethyl)-3-pyridinyl]-1,3-thiazole-4-carboxylate |
| InChIKey | JVEWMCVXHXWPRB-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CSC(=N1)C2=C(C=CN=C2)C(F)(F)F |
Computed by PubChem (NCBI)