Products 2758256-02-7
CAS 2758256-02-7 is the registry number for NMDA receptor modulator 3. Offered by: MedChemExpress. Available pack sizes: Get quote.
5-[[4-(trifluoromethyl)phenyl]sulfanylmethyl]-1,4-dihydropyrazine-2,3-dione (CAS 2758256-02-7) is a chemical compound with the molecular formula C12H9F3N2O2S and a molecular weight of 302.27 g/mol. IUPAC name: 5-[[4-(trifluoromethyl)phenyl]sulfanylmethyl]-1,4-dihydropyrazine-2,3-dione. InChIKey: NWZNILNWDJYNJV-UHFFFAOYSA-N.
| Molecular formula | C12H9F3N2O2S |
|---|---|
| Molecular weight | 302.27 g/mol |
| IUPAC name | 5-[[4-(trifluoromethyl)phenyl]sulfanylmethyl]-1,4-dihydropyrazine-2,3-dione |
| InChIKey | NWZNILNWDJYNJV-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(F)(F)F)SCC2=CNC(=O)C(=O)N2 |
Computed by PubChem (NCBI)