CAS 886502-96-1 is the registry number for 2-(M-Tolylamino)-4-(trifluoromethyl)thiazole-5-carboxylic acid, 95+%. Offered by: AmBeed. Available pack sizes: 5g, 100mg, 250mg, 1g.
2-(3-methylanilino)-4-(trifluoromethyl)-1,3-thiazole-5-carboxylic acid (CAS 886502-96-1) is a chemical compound with the molecular formula C12H9F3N2O2S and a molecular weight of 302.27 g/mol. IUPAC name: 2-(3-methylanilino)-4-(trifluoromethyl)-1,3-thiazole-5-carboxylic acid. InChIKey: RGKWMNAJAJLAOZ-UHFFFAOYSA-N.
| Molecular formula | C12H9F3N2O2S |
|---|---|
| Molecular weight | 302.27 g/mol |
| IUPAC name | 2-(3-methylanilino)-4-(trifluoromethyl)-1,3-thiazole-5-carboxylic acid |
| InChIKey | RGKWMNAJAJLAOZ-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC=C1)NC2=NC(=C(S2)C(=O)O)C(F)(F)F |
Computed by PubChem (NCBI)