Products 886502-96-1

CAS 886502-96-1 is the registry number for 2-(M-Tolylamino)-4-(trifluoromethyl)thiazole-5-carboxylic acid, 95+%. Offered by: AmBeed. Available pack sizes: 5g, 100mg, 250mg, 1g.

Structural formula: {0} (CAS {1})

2-(3-methylanilino)-4-(trifluoromethyl)-1,3-thiazole-5-carboxylic acid (CAS 886502-96-1) is a chemical compound with the molecular formula C12H9F3N2O2S and a molecular weight of 302.27 g/mol. IUPAC name: 2-(3-methylanilino)-4-(trifluoromethyl)-1,3-thiazole-5-carboxylic acid. InChIKey: RGKWMNAJAJLAOZ-UHFFFAOYSA-N.

Identity
Molecular formulaC12H9F3N2O2S
Molecular weight302.27 g/mol
IUPAC name2-(3-methylanilino)-4-(trifluoromethyl)-1,3-thiazole-5-carboxylic acid
InChIKeyRGKWMNAJAJLAOZ-UHFFFAOYSA-N
SMILESCC1=CC(=CC=C1)NC2=NC(=C(S2)C(=O)O)C(F)(F)F

Computed by PubChem (NCBI)