CAS 918793-31-4 is the registry number for 2-(4-(4-(Trifluoromethyl)phenylamino)-3,5-thiazolyl)acetic acid. Offered by: Biosynth. Available pack sizes: 10000mg, 5000mg.
2-[2-[4-(trifluoromethyl)anilino]-1,3-thiazol-4-yl]acetic acid (CAS 918793-31-4) is a chemical compound with the molecular formula C12H9F3N2O2S and a molecular weight of 302.27 g/mol. IUPAC name: 2-[2-[4-(trifluoromethyl)anilino]-1,3-thiazol-4-yl]acetic acid. InChIKey: LQLKGMWSBBEFOY-UHFFFAOYSA-N.
| Molecular formula | C12H9F3N2O2S |
|---|---|
| Molecular weight | 302.27 g/mol |
| IUPAC name | 2-[2-[4-(trifluoromethyl)anilino]-1,3-thiazol-4-yl]acetic acid |
| InChIKey | LQLKGMWSBBEFOY-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(F)(F)F)NC2=NC(=CS2)CC(=O)O |
Computed by PubChem (NCBI)