Products 918793-31-4

CAS 918793-31-4 is the registry number for 2-(4-(4-(Trifluoromethyl)phenylamino)-3,5-thiazolyl)acetic acid. Offered by: Biosynth. Available pack sizes: 10000mg, 5000mg.

Structural formula: {0} (CAS {1})

2-[2-[4-(trifluoromethyl)anilino]-1,3-thiazol-4-yl]acetic acid (CAS 918793-31-4) is a chemical compound with the molecular formula C12H9F3N2O2S and a molecular weight of 302.27 g/mol. IUPAC name: 2-[2-[4-(trifluoromethyl)anilino]-1,3-thiazol-4-yl]acetic acid. InChIKey: LQLKGMWSBBEFOY-UHFFFAOYSA-N.

Identity
Molecular formulaC12H9F3N2O2S
Molecular weight302.27 g/mol
IUPAC name2-[2-[4-(trifluoromethyl)anilino]-1,3-thiazol-4-yl]acetic acid
InChIKeyLQLKGMWSBBEFOY-UHFFFAOYSA-N
SMILESC1=CC(=CC=C1C(F)(F)F)NC2=NC(=CS2)CC(=O)O

Computed by PubChem (NCBI)