CAS 1235545-45-5 is the registry number for 7-(Trifluoromethyl)imidazo[1,2-b]pyridazine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
7-(trifluoromethyl)imidazo[1,2-b]pyridazine (CAS 1235545-45-5) is a chemical compound with the molecular formula C7H4F3N3 and a molecular weight of 187.12 g/mol. IUPAC name: 7-(trifluoromethyl)imidazo[1,2-b]pyridazine. InChIKey: SWFFDRXLHHQYQZ-UHFFFAOYSA-N.
| Molecular formula | C7H4F3N3 |
|---|---|
| Molecular weight | 187.12 g/mol |
| IUPAC name | 7-(trifluoromethyl)imidazo[1,2-b]pyridazine |
| InChIKey | SWFFDRXLHHQYQZ-UHFFFAOYSA-N |
| SMILES | C1=CN2C(=N1)C=C(C=N2)C(F)(F)F |
Computed by PubChem (NCBI)