Products 1236305-45-5
CAS 1236305-45-5 is the registry number for Methyl 2,6-dichloro-α,α-dimethylbenzeneacetate, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 1g, 2,5g, 5g, 10g, 25g.
Methyl 2-(2,6-dichlorophenyl)-2-methylpropanoate (CAS 1236305-45-5) is a chemical compound with the molecular formula C11H12Cl2O2 and a molecular weight of 247.11 g/mol. IUPAC name: methyl 2-(2,6-dichlorophenyl)-2-methylpropanoate. InChIKey: VBYLGPMJSMCXQT-UHFFFAOYSA-N.
| Molecular formula | C11H12Cl2O2 |
|---|---|
| Molecular weight | 247.11 g/mol |
| IUPAC name | methyl 2-(2,6-dichlorophenyl)-2-methylpropanoate |
| InChIKey | VBYLGPMJSMCXQT-UHFFFAOYSA-N |
| SMILES | CC(C)(C1=C(C=CC=C1Cl)Cl)C(=O)OC |
Computed by PubChem (NCBI)