CAS 41715-70-2 is the registry number for 1-(2,3-Dichloro-4-methoxyphenyl)-1-butanone. Offered by: TRC. Available pack sizes: 5g.
1-(2,3-dichloro-4-methoxyphenyl)butan-1-one (CAS 41715-70-2) is a chemical compound with the molecular formula C11H12Cl2O2 and a molecular weight of 247.11 g/mol. IUPAC name: 1-(2,3-dichloro-4-methoxyphenyl)butan-1-one. InChIKey: NLWYCNCBSFKVBG-UHFFFAOYSA-N.
| Molecular formula | C11H12Cl2O2 |
|---|---|
| Molecular weight | 247.11 g/mol |
| IUPAC name | 1-(2,3-dichloro-4-methoxyphenyl)butan-1-one |
| InChIKey | NLWYCNCBSFKVBG-UHFFFAOYSA-N |
| SMILES | CCCC(=O)C1=C(C(=C(C=C1)OC)Cl)Cl |
Computed by PubChem (NCBI)