Products 1470584-30-5

CAS 1470584-30-5 is the registry number for 2,6-Dichlorobenzeneacetic Acid 1-Methylethyl Ester, >95% (HPLC). Offered by: TRC. Available pack sizes: 100mg.

Structural formula: {0} (CAS {1})

Propan-2-yl 2-(2,6-dichlorophenyl)acetate (CAS 1470584-30-5) is a chemical compound with the molecular formula C11H12Cl2O2 and a molecular weight of 247.11 g/mol. IUPAC name: propan-2-yl 2-(2,6-dichlorophenyl)acetate. InChIKey: XLDVQLKUCUZLGO-UHFFFAOYSA-N.

Identity
Molecular formulaC11H12Cl2O2
Molecular weight247.11 g/mol
IUPAC namepropan-2-yl 2-(2,6-dichlorophenyl)acetate
InChIKeyXLDVQLKUCUZLGO-UHFFFAOYSA-N
SMILESCC(C)OC(=O)CC1=C(C=CC=C1Cl)Cl

Computed by PubChem (NCBI)