CAS 1470584-30-5 is the registry number for 2,6-Dichlorobenzeneacetic Acid 1-Methylethyl Ester, >95% (HPLC). Offered by: TRC. Available pack sizes: 100mg.
Propan-2-yl 2-(2,6-dichlorophenyl)acetate (CAS 1470584-30-5) is a chemical compound with the molecular formula C11H12Cl2O2 and a molecular weight of 247.11 g/mol. IUPAC name: propan-2-yl 2-(2,6-dichlorophenyl)acetate. InChIKey: XLDVQLKUCUZLGO-UHFFFAOYSA-N.
| Molecular formula | C11H12Cl2O2 |
|---|---|
| Molecular weight | 247.11 g/mol |
| IUPAC name | propan-2-yl 2-(2,6-dichlorophenyl)acetate |
| InChIKey | XLDVQLKUCUZLGO-UHFFFAOYSA-N |
| SMILES | CC(C)OC(=O)CC1=C(C=CC=C1Cl)Cl |
Computed by PubChem (NCBI)