CAS 127715-97-3 appears in our catalog under these names: tert-Butyl 2,5-dichlorobenzoate, 97%, tert-Butyl 2,5-dichlorobenzoate, 95%, 95%. Offered by: AmBeed, Chemat. Available pack sizes: 25g, 100mg, 250mg, 1g, 5g.
Tert-butyl 2,5-dichlorobenzoate (CAS 127715-97-3) is a chemical compound with the molecular formula C11H12Cl2O2 and a molecular weight of 247.11 g/mol. IUPAC name: tert-butyl 2,5-dichlorobenzoate. InChIKey: DEYYQBCKOVYDLK-UHFFFAOYSA-N.
| Molecular formula | C11H12Cl2O2 |
|---|---|
| Molecular weight | 247.11 g/mol |
| IUPAC name | tert-butyl 2,5-dichlorobenzoate |
| InChIKey | DEYYQBCKOVYDLK-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)C1=C(C=CC(=C1)Cl)Cl |
Computed by PubChem (NCBI)