Products 1236861-74-7
CAS 1236861-74-7 appears in our catalog under these names: 3-(3-Chlorophenoxy)azetidine hydrochloride, 95%, 3-(3-Chlorophenoxy)azetidine hydrochloride. Offered by: Combi-blocks, Biosynth. Available pack sizes: 10g, 1g, 250mg, 5g, 0,5g.
3-(3-chlorophenoxy)azetidine;hydrochloride (CAS 1236861-74-7) is a chemical compound with the molecular formula C9H11Cl2NO and a molecular weight of 220.09 g/mol. IUPAC name: 3-(3-chlorophenoxy)azetidine;hydrochloride. InChIKey: VQTQYPNUHRUNBI-UHFFFAOYSA-N.
| Molecular formula | C9H11Cl2NO |
|---|---|
| Molecular weight | 220.09 g/mol |
| IUPAC name | 3-(3-chlorophenoxy)azetidine;hydrochloride |
| InChIKey | VQTQYPNUHRUNBI-UHFFFAOYSA-N |
| SMILES | C1C(CN1)OC2=CC(=CC=C2)Cl.Cl |
Computed by PubChem (NCBI)