CAS 123704-99-4 appears in our catalog under these names: Granisetron Impurity 3, N-(2,3-dioxoindolin-1-yl)acetamide. Offered by: Chemat Brand. Available pack sizes: on request.
N-(2,3-dioxoindol-1-yl)acetamide (CAS 123704-99-4) is a chemical compound with the molecular formula C10H8N2O3 and a molecular weight of 204.18 g/mol. IUPAC name: N-(2,3-dioxoindol-1-yl)acetamide. InChIKey: MYILLZWVQDXGDW-UHFFFAOYSA-N.
| Molecular formula | C10H8N2O3 |
|---|---|
| Molecular weight | 204.18 g/mol |
| IUPAC name | N-(2,3-dioxoindol-1-yl)acetamide |
| InChIKey | MYILLZWVQDXGDW-UHFFFAOYSA-N |
| SMILES | CC(=O)NN1C2=CC=CC=C2C(=O)C1=O |
Computed by PubChem (NCBI)