Products 1958012-27-5
CAS 1958012-27-5 appears in our catalog under these names: 6-Ethynyl-3-tosyl-1,3-oxazinan-2-one, 98%, 6-Ethynyltetrahydro-3-[(4-methylphenyl)sulfonyl]-2H-1,3-oxazin-2-one, 98%, 98%, 6-Ethynyltetrahydro-3-[(4-methylphenyl)sulfonyl]-2H-1,3-oxazin-2-one, 98%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 50mg, 100mg, 10mg, 25mg.
6-ethynyl-3-(4-methylphenyl)sulfonyl-1,3-oxazinan-2-one (CAS 1958012-27-5) is a chemical compound with the molecular formula C13H13NO4S and a molecular weight of 279.31 g/mol. IUPAC name: 6-ethynyl-3-(4-methylphenyl)sulfonyl-1,3-oxazinan-2-one. InChIKey: QWSOAZOZNYJCRT-UHFFFAOYSA-N.
| Molecular formula | C13H13NO4S |
|---|---|
| Molecular weight | 279.31 g/mol |
| IUPAC name | 6-ethynyl-3-(4-methylphenyl)sulfonyl-1,3-oxazinan-2-one |
| InChIKey | QWSOAZOZNYJCRT-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)N2CCC(OC2=O)C#C |
Computed by PubChem (NCBI)