Products 123760-95-2
CAS 123760-95-2 is the registry number for (2S)-2-{((4-Chlorophenyl)methyl)amino}propanoic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
(2S)-2-[(4-chlorophenyl)methylamino]propanoic acid (CAS 123760-95-2) is a chemical compound with the molecular formula C10H12ClNO2 and a molecular weight of 213.66 g/mol. IUPAC name: (2S)-2-[(4-chlorophenyl)methylamino]propanoic acid. InChIKey: FBMVXXOKUYWDEC-ZETCQYMHSA-N.
| Molecular formula | C10H12ClNO2 |
|---|---|
| Molecular weight | 213.66 g/mol |
| IUPAC name | (2S)-2-[(4-chlorophenyl)methylamino]propanoic acid |
| InChIKey | FBMVXXOKUYWDEC-ZETCQYMHSA-N |
| SMILES | C[C@@H](C(=O)O)NCC1=CC=C(C=C1)Cl |
Computed by PubChem (NCBI)