CAS 123811-77-8 is the registry number for rel-(2R,3S)-3-Methylpiperidine-2-carboxylic acid hydrochloride, 95%. Offered by: AmBeed. Available pack sizes: 1g.
(2R,3S)-3-methylpiperidine-2-carboxylic acid;hydrochloride (CAS 123811-77-8) is a chemical compound with the molecular formula C7H14ClNO2 and a molecular weight of 179.64 g/mol. IUPAC name: (2R,3S)-3-methylpiperidine-2-carboxylic acid;hydrochloride. InChIKey: ZRDPTHZAEZSISM-RIHPBJNCSA-N.
| Molecular formula | C7H14ClNO2 |
|---|---|
| Molecular weight | 179.64 g/mol |
| IUPAC name | (2R,3S)-3-methylpiperidine-2-carboxylic acid;hydrochloride |
| InChIKey | ZRDPTHZAEZSISM-RIHPBJNCSA-N |
| SMILES | C[C@H]1CCCN[C@H]1C(=O)O.Cl |
Computed by PubChem (NCBI)