Products 1808455-06-2
CAS 1808455-06-2 appears in our catalog under these names: (2R,3S)-3-Methylpiperidine-2-carboxylic Acid Hydrochloride Salt, (2R,3S)-3-Methylpiperidine-2-carboxylic acid hydrochloride, 98%, 98%, (2R,3S)-3-Methylpiperidine-2-carboxylic acid hydrochloride, 98%. Offered by: TRC, Chemat, Ambeed. Available pack sizes: 1g, 100mg, 250mg, 5g.
(2R,3S)-3-methylpiperidine-2-carboxylic acid;hydrochloride (CAS 1808455-06-2) is a chemical compound with the molecular formula C7H14ClNO2 and a molecular weight of 179.64 g/mol. IUPAC name: (2R,3S)-3-methylpiperidine-2-carboxylic acid;hydrochloride. InChIKey: ZRDPTHZAEZSISM-RIHPBJNCSA-N.
| Molecular formula | C7H14ClNO2 |
|---|---|
| Molecular weight | 179.64 g/mol |
| IUPAC name | (2R,3S)-3-methylpiperidine-2-carboxylic acid;hydrochloride |
| InChIKey | ZRDPTHZAEZSISM-RIHPBJNCSA-N |
| SMILES | C[C@H]1CCCN[C@H]1C(=O)O.Cl |
Computed by PubChem (NCBI)