Products 1238854-21-1
CAS 1238854-21-1 is the registry number for 3,3′′-Dimethyl [1,1′:4′,1′′-terphenyl]-3,3′′-dicarboxylate, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g.
Methyl 3-[4-(3-methoxycarbonylphenyl)phenyl]benzoate (CAS 1238854-21-1) is a chemical compound with the molecular formula C22H18O4 and a molecular weight of 346.4 g/mol. IUPAC name: methyl 3-[4-(3-methoxycarbonylphenyl)phenyl]benzoate. InChIKey: FNDRNYPWIFMFCO-UHFFFAOYSA-N.
| Molecular formula | C22H18O4 |
|---|---|
| Molecular weight | 346.4 g/mol |
| IUPAC name | methyl 3-[4-(3-methoxycarbonylphenyl)phenyl]benzoate |
| InChIKey | FNDRNYPWIFMFCO-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC=CC(=C1)C2=CC=C(C=C2)C3=CC(=CC=C3)C(=O)OC |
Computed by PubChem (NCBI)