CAS 123971-44-8 appears in our catalog under these names: 4-(3-Ethylphenyl)thiazol-2-amine, 98%, 4-(3-ethylphenyl)-1,3-thiazol-2-amine, 95%, 95%, 4-(3-ETHYLPHENYL)-1,3-THIAZOL-2-AMINE, 95%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 1g, 100mg, 250mg.
4-(3-ethylphenyl)-1,3-thiazol-2-amine (CAS 123971-44-8) is a chemical compound with the molecular formula C11H12N2S and a molecular weight of 204.29 g/mol. IUPAC name: 4-(3-ethylphenyl)-1,3-thiazol-2-amine. InChIKey: ORLWLAIIAJLSRP-UHFFFAOYSA-N.
| Molecular formula | C11H12N2S |
|---|---|
| Molecular weight | 204.29 g/mol |
| IUPAC name | 4-(3-ethylphenyl)-1,3-thiazol-2-amine |
| InChIKey | ORLWLAIIAJLSRP-UHFFFAOYSA-N |
| SMILES | CCC1=CC(=CC=C1)C2=CSC(=N2)N |
Computed by PubChem (NCBI)