CAS 1239735-00-2 is the registry number for Thieno(3,2-c)pyridine-6-carbohydrazide. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
Thieno[3,2-c]pyridine-6-carbohydrazide (CAS 1239735-00-2) is a chemical compound with the molecular formula C8H7N3OS and a molecular weight of 193.23 g/mol. IUPAC name: thieno[3,2-c]pyridine-6-carbohydrazide. InChIKey: ALLFEIWQABAIMY-UHFFFAOYSA-N.
| Molecular formula | C8H7N3OS |
|---|---|
| Molecular weight | 193.23 g/mol |
| IUPAC name | thieno[3,2-c]pyridine-6-carbohydrazide |
| InChIKey | ALLFEIWQABAIMY-UHFFFAOYSA-N |
| SMILES | C1=CSC2=CC(=NC=C21)C(=O)NN |
Computed by PubChem (NCBI)