CAS 1239735-33-1 appears in our catalog under these names: 1-(Pyrimidin-2-yl)-1H-imidazole-4-carboxylic acid, 97%, 1-(Pyrimidin-2-yl)-1H-imidazole-4-carboxylic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
1-pyrimidin-2-ylimidazole-4-carboxylic acid (CAS 1239735-33-1) is a chemical compound with the molecular formula C8H6N4O2 and a molecular weight of 190.16 g/mol. IUPAC name: 1-pyrimidin-2-ylimidazole-4-carboxylic acid. InChIKey: VFHAZSBLHLXOEB-UHFFFAOYSA-N.
| Molecular formula | C8H6N4O2 |
|---|---|
| Molecular weight | 190.16 g/mol |
| IUPAC name | 1-pyrimidin-2-ylimidazole-4-carboxylic acid |
| InChIKey | VFHAZSBLHLXOEB-UHFFFAOYSA-N |
| SMILES | C1=CN=C(N=C1)N2C=C(N=C2)C(=O)O |
Computed by PubChem (NCBI)