Products 1240279-47-3
CAS 1240279-47-3 is the registry number for 5-(Thiophen-2-yl)-1H-pyrazole-3-carboxamide, 97%, 97%. Offered by: Chemat. Available pack sizes: 1g.
5-thiophen-2-yl-1H-pyrazole-3-carboxamide (CAS 1240279-47-3) is a chemical compound with the molecular formula C8H7N3OS and a molecular weight of 193.23 g/mol. IUPAC name: 5-thiophen-2-yl-1H-pyrazole-3-carboxamide. InChIKey: ICHSQXBOKLWZJI-UHFFFAOYSA-N.
| Molecular formula | C8H7N3OS |
|---|---|
| Molecular weight | 193.23 g/mol |
| IUPAC name | 5-thiophen-2-yl-1H-pyrazole-3-carboxamide |
| InChIKey | ICHSQXBOKLWZJI-UHFFFAOYSA-N |
| SMILES | C1=CSC(=C1)C2=CC(=NN2)C(=O)N |
Computed by PubChem (NCBI)