Products 1240328-13-5

CAS 1240328-13-5 is the registry number for Methyl 5-amino-2,6-dichloronicotinate, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.

Structural formula: {0} (CAS {1})

Methyl 5-amino-2,6-dichloropyridine-3-carboxylate (CAS 1240328-13-5) is a chemical compound with the molecular formula C7H6Cl2N2O2 and a molecular weight of 221.04 g/mol. IUPAC name: methyl 5-amino-2,6-dichloropyridine-3-carboxylate. InChIKey: PYJPCCLYEQIMKK-UHFFFAOYSA-N.

Identity
Molecular formulaC7H6Cl2N2O2
Molecular weight221.04 g/mol
IUPAC namemethyl 5-amino-2,6-dichloropyridine-3-carboxylate
InChIKeyPYJPCCLYEQIMKK-UHFFFAOYSA-N
SMILESCOC(=O)C1=CC(=C(N=C1Cl)Cl)N

Computed by PubChem (NCBI)