CAS 1240328-13-5 is the registry number for Methyl 5-amino-2,6-dichloronicotinate, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
Methyl 5-amino-2,6-dichloropyridine-3-carboxylate (CAS 1240328-13-5) is a chemical compound with the molecular formula C7H6Cl2N2O2 and a molecular weight of 221.04 g/mol. IUPAC name: methyl 5-amino-2,6-dichloropyridine-3-carboxylate. InChIKey: PYJPCCLYEQIMKK-UHFFFAOYSA-N.
| Molecular formula | C7H6Cl2N2O2 |
|---|---|
| Molecular weight | 221.04 g/mol |
| IUPAC name | methyl 5-amino-2,6-dichloropyridine-3-carboxylate |
| InChIKey | PYJPCCLYEQIMKK-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=C(N=C1Cl)Cl)N |
Computed by PubChem (NCBI)