CAS 130159-58-9 is the registry number for 4,5-Dichloro-2-(2-oxopropyl)-2,3-dihydropyridazin-3-one, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
4,5-dichloro-2-(2-oxopropyl)pyridazin-3-one (CAS 130159-58-9) is a chemical compound with the molecular formula C7H6Cl2N2O2 and a molecular weight of 221.04 g/mol. IUPAC name: 4,5-dichloro-2-(2-oxopropyl)pyridazin-3-one. InChIKey: SANUBZIVOXVSHK-UHFFFAOYSA-N.
| Molecular formula | C7H6Cl2N2O2 |
|---|---|
| Molecular weight | 221.04 g/mol |
| IUPAC name | 4,5-dichloro-2-(2-oxopropyl)pyridazin-3-one |
| InChIKey | SANUBZIVOXVSHK-UHFFFAOYSA-N |
| SMILES | CC(=O)CN1C(=O)C(=C(C=N1)Cl)Cl |
Computed by PubChem (NCBI)