CAS 2173991-74-5 is the registry number for 2,5-Dichloro-N,4-dihydroxybenzimidamide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2,5-dichloro-N',4-dihydroxybenzenecarboximidamide (CAS 2173991-74-5) is a chemical compound with the molecular formula C7H6Cl2N2O2 and a molecular weight of 221.04 g/mol. IUPAC name: 2,5-dichloro-N',4-dihydroxybenzenecarboximidamide. InChIKey: NKLKMELKAPCHDE-UHFFFAOYSA-N.
| Molecular formula | C7H6Cl2N2O2 |
|---|---|
| Molecular weight | 221.04 g/mol |
| IUPAC name | 2,5-dichloro-N',4-dihydroxybenzenecarboximidamide |
| InChIKey | NKLKMELKAPCHDE-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1Cl)O)Cl)C(=NO)N |
Computed by PubChem (NCBI)