CAS 23964-29-6 is the registry number for 3,5-Dichloro-4-hydroxybenzohydrazide, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
3,5-dichloro-4-hydroxybenzohydrazide (CAS 23964-29-6) is a chemical compound with the molecular formula C7H6Cl2N2O2 and a molecular weight of 221.04 g/mol. IUPAC name: 3,5-dichloro-4-hydroxybenzohydrazide. InChIKey: YAECGTGIGJYKPO-UHFFFAOYSA-N.
| Molecular formula | C7H6Cl2N2O2 |
|---|---|
| Molecular weight | 221.04 g/mol |
| IUPAC name | 3,5-dichloro-4-hydroxybenzohydrazide |
| InChIKey | YAECGTGIGJYKPO-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1Cl)O)Cl)C(=O)NN |
Computed by PubChem (NCBI)