Products 212650-39-0

CAS 212650-39-0 appears in our catalog under these names: 2,6-Dichloro-4-pyrimidinepropanoic acid, 98%, 2,6–Dichloro–4–pyrimidinepropanoic Acid, 2,6-Dichloro-4-pyrimidinepropanoic Acid, 98%, 98%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 5g, 25g, 10g, 1g, 250mg, 100mg.

Structural formula: {0} (CAS {1})

3-(2,6-dichloropyrimidin-4-yl)propanoic acid (CAS 212650-39-0) is a chemical compound with the molecular formula C7H6Cl2N2O2 and a molecular weight of 221.04 g/mol. IUPAC name: 3-(2,6-dichloropyrimidin-4-yl)propanoic acid. InChIKey: JNJOJPVJDFNUNZ-UHFFFAOYSA-N.

Identity
Molecular formulaC7H6Cl2N2O2
Molecular weight221.04 g/mol
IUPAC name3-(2,6-dichloropyrimidin-4-yl)propanoic acid
InChIKeyJNJOJPVJDFNUNZ-UHFFFAOYSA-N
SMILESC1=C(N=C(N=C1Cl)Cl)CCC(=O)O

Computed by PubChem (NCBI)