CAS 350601-39-7 appears in our catalog under these names: Methyl 4-amino-3,6-dichloropicolinate, 95%, Methyl 4-Amino-3,6-dichloropyridine-2-carboxylate, Methyl 4–amino–3,6–dichloropicolinate, Methyl 4-amino-3,6-dichloropicolinate 97%, Methyl 4-amino-3,6-dichloropicolinate, 97%, 97%. Offered by: Combi-blocks, TRC, GLPBio, Ambeed, Chemat. Available pack sizes: 250mg, 1g, 100mg, 10mg, 25mg, 5mg, 5g, 25g.
Methyl 4-amino-3,6-dichloropyridine-2-carboxylate (CAS 350601-39-7) is a chemical compound with the molecular formula C7H6Cl2N2O2 and a molecular weight of 221.04 g/mol. IUPAC name: methyl 4-amino-3,6-dichloropyridine-2-carboxylate. InChIKey: FRMBCYILCYTPHY-UHFFFAOYSA-N.
| Molecular formula | C7H6Cl2N2O2 |
|---|---|
| Molecular weight | 221.04 g/mol |
| IUPAC name | methyl 4-amino-3,6-dichloropyridine-2-carboxylate |
| InChIKey | FRMBCYILCYTPHY-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C(=CC(=N1)Cl)N)Cl |
Computed by PubChem (NCBI)