CAS 1240528-06-6 appears in our catalog under these names: 3-(2,3-Dioxo-1,2,3,4-tetrahydropyrazin-1-yl)propanoic acid, 98%, 3-(2,3-Dioxo-1,2,3,4-tetrahydropyrazin-1-yl)propanoic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 10g, 100mg, 1g.
3-(2,3-dioxo-1H-pyrazin-4-yl)propanoic acid (CAS 1240528-06-6) is a chemical compound with the molecular formula C7H8N2O4 and a molecular weight of 184.15 g/mol. IUPAC name: 3-(2,3-dioxo-1H-pyrazin-4-yl)propanoic acid. InChIKey: HOTUXCYCSCDRGV-UHFFFAOYSA-N.
| Molecular formula | C7H8N2O4 |
|---|---|
| Molecular weight | 184.15 g/mol |
| IUPAC name | 3-(2,3-dioxo-1H-pyrazin-4-yl)propanoic acid |
| InChIKey | HOTUXCYCSCDRGV-UHFFFAOYSA-N |
| SMILES | C1=CN(C(=O)C(=O)N1)CCC(=O)O |
Computed by PubChem (NCBI)